C24H30FN5O6 — CID 143973240
N'-[[(6S,10R)-2-[(4-fluoro-3-methylphenyl)methylcarbamoyl]-3-hydroxy-6-methyl-4-oxo-6,7,9,10-tetrahydropyrimido[1,2-d][1,4]oxazepin-10-yl]methyl]-N,N,N'-trimethyloxamide (PubChem CID 143973240) has the molecular formula C24H30FN5O6 and a molecular weight of 503.53 g/mol. Its IUPAC name is N'-[[(6S,10R)-2-[(4-fluoro-3-methylphenyl)methylcarbamoyl]-3-hydroxy-6-methyl-4-oxo-6,7,9,10-tetrahydropyrimido[1,2-d][1,4]oxazepin-10-yl]methyl]-N,N,N'-trimethyloxamide.
| Compound Name | N'-[[(6S,10R)-2-[(4-fluoro-3-methylphenyl)methylcarbamoyl]-3-hydroxy-6-methyl-4-oxo-6,7,9,10-tetrahydropyrimido[1,2-d][1,4]oxazepin-10-yl]methyl]-N,N,N'-trimethyloxamide |
|---|---|
| PubChem CID | 143973240 |
| Molecular Formula | C24H30FN5O6 |
| Molecular Weight | 503.53 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | N'-[[(6S,10R)-2-[(4-fluoro-3-methylphenyl)methylcarbamoyl]-3-hydroxy-6-methyl-4-oxo-6,7,9,10-tetrahydropyrimido[1,2-d][1,4]oxazepin-10-yl]methyl]-N,N,N'-trimethyloxamide |
| SMILES | Cc1cc(CNC(=O)c2nc3n(c(=O)c2O)[C@@H](C)COC[C@@H]3CN(C)C(=O)C(=O)N(C)C)ccc1F |
| InChI | InChI=1S/C24H30FN5O6/c1-13-8-15(6-7-17(13)25)9-26-21(32)18-19(31)22(33)30-14(2)11-36-12-16(20(30)27-18)10-29(5)24(35)23(34)28(3)4/h6-8,14,16,31H,9-12H2,1-5H3,(H,26,32)/t14-,16-/m0/s1 |
| InChIKey | ZYMRHFYAWIENNT-HOCLYGCPSA-N |
| XLogP | 0.55 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.53 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|