C24H29FN4O6 — CID 158001766
N'-[(6R,10R)-6-ethyl-2-[3-(4-fluorophenyl)propanoyl]-3-hydroxy-4-oxo-6,7,9,10-tetrahydropyrimido[1,2-d][1,4]oxazepin-10-yl]-N,N,N'-trimethyloxamide (PubChem CID 158001766) has the molecular formula C24H29FN4O6 and a molecular weight of 488.52 g/mol. Its IUPAC name is N'-[(6R,10R)-6-ethyl-2-[3-(4-fluorophenyl)propanoyl]-3-hydroxy-4-oxo-6,7,9,10-tetrahydropyrimido[1,2-d][1,4]oxazepin-10-yl]-N,N,N'-trimethyloxamide.
| Compound Name | N'-[(6R,10R)-6-ethyl-2-[3-(4-fluorophenyl)propanoyl]-3-hydroxy-4-oxo-6,7,9,10-tetrahydropyrimido[1,2-d][1,4]oxazepin-10-yl]-N,N,N'-trimethyloxamide |
|---|---|
| PubChem CID | 158001766 |
| Molecular Formula | C24H29FN4O6 |
| Molecular Weight | 488.52 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | N'-[(6R,10R)-6-ethyl-2-[3-(4-fluorophenyl)propanoyl]-3-hydroxy-4-oxo-6,7,9,10-tetrahydropyrimido[1,2-d][1,4]oxazepin-10-yl]-N,N,N'-trimethyloxamide |
| SMILES | CC[C@@H]1COC[C@H](N(C)C(=O)C(=O)N(C)C)c2nc(C(=O)CCc3ccc(F)cc3)c(O)c(=O)n21 |
| InChI | InChI=1S/C24H29FN4O6/c1-5-16-12-35-13-17(28(4)24(34)23(33)27(2)3)21-26-19(20(31)22(32)29(16)21)18(30)11-8-14-6-9-15(25)10-7-14/h6-7,9-10,16-17,31H,5,8,11-13H2,1-4H3/t16-,17+/m1/s1 |
| InChIKey | FDUWKCSAGNIDHY-SJORKVTESA-N |
| XLogP | 1.47 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.52 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|