C27H34FN5O5 — CID 123469584
N-[[2-[but-3-enyl(methyl)amino]-4-fluorophenyl]methyl]-6-ethyl-3-hydroxy-10-[methyl(prop-2-enoyl)amino]-4-oxo-6,7,9,10-tetrahydropyrimido[1,2-d][1,4]oxazepine-2-carboxamide (PubChem CID 123469584) has the molecular formula C27H34FN5O5 and a molecular weight of 527.60 g/mol. Its IUPAC name is N-[[2-[but-3-enyl(methyl)amino]-4-fluorophenyl]methyl]-6-ethyl-3-hydroxy-10-[methyl(prop-2-enoyl)amino]-4-oxo-6,7,9,10-tetrahydropyrimido[1,2-d][1,4]oxazepine-2-carboxamide.
| Compound Name | N-[[2-[but-3-enyl(methyl)amino]-4-fluorophenyl]methyl]-6-ethyl-3-hydroxy-10-[methyl(prop-2-enoyl)amino]-4-oxo-6,7,9,10-tetrahydropyrimido[1,2-d][1,4]oxazepine-2-carboxamide |
|---|---|
| PubChem CID | 123469584 |
| Molecular Formula | C27H34FN5O5 |
| Molecular Weight | 527.60 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | N-[[2-[but-3-enyl(methyl)amino]-4-fluorophenyl]methyl]-6-ethyl-3-hydroxy-10-[methyl(prop-2-enoyl)amino]-4-oxo-6,7,9,10-tetrahydropyrimido[1,2-d][1,4]oxazepine-2-carboxamide |
| SMILES | C=CCCN(C)c1cc(F)ccc1CNC(=O)c1nc2n(c(=O)c1O)C(CC)COCC2N(C)C(=O)C=C |
| InChI | InChI=1S/C27H34FN5O5/c1-6-9-12-31(4)20-13-18(28)11-10-17(20)14-29-26(36)23-24(35)27(37)33-19(7-2)15-38-16-21(25(33)30-23)32(5)22(34)8-3/h6,8,10-11,13,19,21,35H,1,3,7,9,12,14-16H2,2,4-5H3,(H,29,36) |
| InChIKey | XQNZUGAARHWOKP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.60 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|