C26H32ClN5O5 — CID 58476827
N'-[2-[3-(3-chloro-4-methylphenyl)propanoyl]-8-cyclopropyl-3-hydroxy-4-oxo-6,7,9,10-tetrahydropyrimido[1,2-d][1,4]diazepin-10-yl]-N,N,N'-trimethyloxamide (PubChem CID 58476827) has the molecular formula C26H32ClN5O5 and a molecular weight of 530.03 g/mol. Its IUPAC name is N'-[2-[3-(3-chloro-4-methylphenyl)propanoyl]-8-cyclopropyl-3-hydroxy-4-oxo-6,7,9,10-tetrahydropyrimido[1,2-d][1,4]diazepin-10-yl]-N,N,N'-trimethyloxamide.
| Compound Name | N'-[2-[3-(3-chloro-4-methylphenyl)propanoyl]-8-cyclopropyl-3-hydroxy-4-oxo-6,7,9,10-tetrahydropyrimido[1,2-d][1,4]diazepin-10-yl]-N,N,N'-trimethyloxamide |
|---|---|
| PubChem CID | 58476827 |
| Molecular Formula | C26H32ClN5O5 |
| Molecular Weight | 530.03 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | N'-[2-[3-(3-chloro-4-methylphenyl)propanoyl]-8-cyclopropyl-3-hydroxy-4-oxo-6,7,9,10-tetrahydropyrimido[1,2-d][1,4]diazepin-10-yl]-N,N,N'-trimethyloxamide |
| SMILES | Cc1ccc(CCC(=O)c2nc3n(c(=O)c2O)CCN(C2CC2)CC3N(C)C(=O)C(=O)N(C)C)cc1Cl |
| InChI | InChI=1S/C26H32ClN5O5/c1-15-5-6-16(13-18(15)27)7-10-20(33)21-22(34)24(35)32-12-11-31(17-8-9-17)14-19(23(32)28-21)30(4)26(37)25(36)29(2)3/h5-6,13,17,19,34H,7-12,14H2,1-4H3 |
| InChIKey | QEZVKNJYRQDTHG-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 116.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.03 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|