C19H29N3O6 — CID 70970116
ethyl 2-[1-(butoxycarbonylamino)cyclopentyl]-1-ethyl-5-hydroxy-6-oxopyrimidine-4-carboxylate (PubChem CID 70970116) has the molecular formula C19H29N3O6 and a molecular weight of 395.46 g/mol. Its IUPAC name is ethyl 2-[1-(butoxycarbonylamino)cyclopentyl]-1-ethyl-5-hydroxy-6-oxopyrimidine-4-carboxylate.
| Compound Name | ethyl 2-[1-(butoxycarbonylamino)cyclopentyl]-1-ethyl-5-hydroxy-6-oxopyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 70970116 |
| Molecular Formula | C19H29N3O6 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | ethyl 2-[1-(butoxycarbonylamino)cyclopentyl]-1-ethyl-5-hydroxy-6-oxopyrimidine-4-carboxylate |
| SMILES | CCCCOC(=O)NC1(c2nc(C(=O)OCC)c(O)c(=O)n2CC)CCCC1 |
| InChI | InChI=1S/C19H29N3O6/c1-4-7-12-28-18(26)21-19(10-8-9-11-19)17-20-13(16(25)27-6-3)14(23)15(24)22(17)5-2/h23H,4-12H2,1-3H3,(H,21,26) |
| InChIKey | UNCZPVYFJKAFTF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|