C12H16ClN3O — CID 709729
(5S,7R)-3-(3-chloro-1,2,4-triazol-1-yl)adamantan-1-ol (PubChem CID 709729) has the molecular formula C12H16ClN3O and a molecular weight of 253.73 g/mol. Its IUPAC name is (5S,7R)-3-(3-chloro-1,2,4-triazol-1-yl)adamantan-1-ol.
| Compound Name | (5S,7R)-3-(3-chloro-1,2,4-triazol-1-yl)adamantan-1-ol |
|---|---|
| PubChem CID | 709729 |
| Molecular Formula | C12H16ClN3O |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | (5S,7R)-3-(3-chloro-1,2,4-triazol-1-yl)adamantan-1-ol |
| SMILES | OC12C[C@H]3C[C@@H](C1)CC(n1cnc(Cl)n1)(C3)C2 |
| InChI | InChI=1S/C12H16ClN3O/c13-10-14-7-16(15-10)11-2-8-1-9(3-11)5-12(17,4-8)6-11/h7-9,17H,1-6H2/t8-,9+,11?,12? |
| InChIKey | NVQCMQJHJUGJIV-LRSDLPTKSA-N |
| XLogP | 1.97 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |