C21H21Cl2N5O — CID 51391877
2-[(3-chlorophenyl)methyl]-5-[(5S,7R)-3-(3-chloro-1,2,4-triazol-1-yl)-1-adamantyl]-1,3,4-oxadiazole (PubChem CID 51391877) has the molecular formula C21H21Cl2N5O and a molecular weight of 430.34 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methyl]-5-[(5S,7R)-3-(3-chloro-1,2,4-triazol-1-yl)-1-adamantyl]-1,3,4-oxadiazole.
| Compound Name | 2-[(3-chlorophenyl)methyl]-5-[(5S,7R)-3-(3-chloro-1,2,4-triazol-1-yl)-1-adamantyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 51391877 |
| Molecular Formula | C21H21Cl2N5O |
| Molecular Weight | 430.34 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | 2-[(3-chlorophenyl)methyl]-5-[(5S,7R)-3-(3-chloro-1,2,4-triazol-1-yl)-1-adamantyl]-1,3,4-oxadiazole |
| SMILES | Clc1cccc(Cc2nnc(C34C[C@H]5C[C@@H](C3)CC(n3cnc(Cl)n3)(C5)C4)o2)c1 |
| InChI | InChI=1S/C21H21Cl2N5O/c22-16-3-1-2-13(5-16)6-17-25-26-18(29-17)20-7-14-4-15(8-20)10-21(9-14,11-20)28-12-24-19(23)27-28/h1-3,5,12,14-15H,4,6-11H2/t14-,15+,20?,21? |
| InChIKey | ZWTDHRVEOBNZPD-XFKLWTPLSA-N |
| XLogP | 4.81 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.34 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |