C21H17FN2O4S — CID 70978678
(E)-N-[4-(5-fluoro-2-methoxyphenyl)sulfonylphenyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 70978678) has the molecular formula C21H17FN2O4S and a molecular weight of 412.44 g/mol. Its IUPAC name is (E)-N-[4-(5-fluoro-2-methoxyphenyl)sulfonylphenyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-[4-(5-fluoro-2-methoxyphenyl)sulfonylphenyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 70978678 |
| Molecular Formula | C21H17FN2O4S |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | (E)-N-[4-(5-fluoro-2-methoxyphenyl)sulfonylphenyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | COc1ccc(F)cc1S(=O)(=O)c1ccc(NC(=O)/C=C/c2cccnc2)cc1 |
| InChI | InChI=1S/C21H17FN2O4S/c1-28-19-10-5-16(22)13-20(19)29(26,27)18-8-6-17(7-9-18)24-21(25)11-4-15-3-2-12-23-14-15/h2-14H,1H3,(H,24,25)/b11-4+ |
| InChIKey | VFJJEOUJAUJCQO-NYYWCZLTSA-N |
| XLogP | 3.71 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|