C27H22N2O4S — CID 1330387
(E)-2-(benzenesulfonyl)-3-(3-phenoxyphenyl)-N-(pyridin-3-ylmethyl)prop-2-enamide (PubChem CID 1330387) has the molecular formula C27H22N2O4S and a molecular weight of 470.55 g/mol. Its IUPAC name is (E)-2-(benzenesulfonyl)-3-(3-phenoxyphenyl)-N-(pyridin-3-ylmethyl)prop-2-enamide.
| Compound Name | (E)-2-(benzenesulfonyl)-3-(3-phenoxyphenyl)-N-(pyridin-3-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 1330387 |
| Molecular Formula | C27H22N2O4S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | (E)-2-(benzenesulfonyl)-3-(3-phenoxyphenyl)-N-(pyridin-3-ylmethyl)prop-2-enamide |
| SMILES | O=C(NCc1cccnc1)/C(=C\c1cccc(Oc2ccccc2)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C27H22N2O4S/c30-27(29-20-22-10-8-16-28-19-22)26(34(31,32)25-14-5-2-6-15-25)18-21-9-7-13-24(17-21)33-23-11-3-1-4-12-23/h1-19H,20H2,(H,29,30)/b26-18+ |
| InChIKey | CDSCPDODWIMWPB-NLRVBDNBSA-N |
| XLogP | 5.01 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|