C13H18F3N3O5 — CID 70980470
6-(2,5-dioxopyrrol-1-yl)-N'-methylhexanehydrazide;2,2,2-trifluoroacetic acid (PubChem CID 70980470) has the molecular formula C13H18F3N3O5 and a molecular weight of 353.30 g/mol. Its IUPAC name is 6-(2,5-dioxopyrrol-1-yl)-N'-methylhexanehydrazide;2,2,2-trifluoroacetic acid.
| Compound Name | 6-(2,5-dioxopyrrol-1-yl)-N'-methylhexanehydrazide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 70980470 |
| Molecular Formula | C13H18F3N3O5 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 6-(2,5-dioxopyrrol-1-yl)-N'-methylhexanehydrazide;2,2,2-trifluoroacetic acid |
| SMILES | CNNC(=O)CCCCCN1C(=O)C=CC1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C11H17N3O3.C2HF3O2/c1-12-13-9(15)5-3-2-4-8-14-10(16)6-7-11(14)17;3-2(4,5)1(6)7/h6-7,12H,2-5,8H2,1H3,(H,13,15);(H,6,7) |
| InChIKey | KZDJMMNFSFCDQK-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|