C12H15F3N2O5 — CID 175900229
6-(2,5-dioxopyrrol-1-yl)hexanamide;2,2,2-trifluoroacetic acid (PubChem CID 175900229) has the molecular formula C12H15F3N2O5 and a molecular weight of 324.25 g/mol. Its IUPAC name is 6-(2,5-dioxopyrrol-1-yl)hexanamide;2,2,2-trifluoroacetic acid.
| Compound Name | 6-(2,5-dioxopyrrol-1-yl)hexanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175900229 |
| Molecular Formula | C12H15F3N2O5 |
| Molecular Weight | 324.25 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 6-(2,5-dioxopyrrol-1-yl)hexanamide;2,2,2-trifluoroacetic acid |
| SMILES | NC(=O)CCCCCN1C(=O)C=CC1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C10H14N2O3.C2HF3O2/c11-8(13)4-2-1-3-7-12-9(14)5-6-10(12)15;3-2(4,5)1(6)7/h5-6H,1-4,7H2,(H2,11,13);(H,6,7) |
| InChIKey | RUZQJBITJKRPJF-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.25 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|