C12H15F3N2O5 — CID 162232243
1-(6-amino-3-oxohexyl)pyrrole-2,5-dione;2,2,2-trifluoroacetic acid (PubChem CID 162232243) has the molecular formula C12H15F3N2O5 and a molecular weight of 324.25 g/mol. Its IUPAC name is 1-(6-amino-3-oxohexyl)pyrrole-2,5-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 1-(6-amino-3-oxohexyl)pyrrole-2,5-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 162232243 |
| Molecular Formula | C12H15F3N2O5 |
| Molecular Weight | 324.25 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 1-(6-amino-3-oxohexyl)pyrrole-2,5-dione;2,2,2-trifluoroacetic acid |
| SMILES | NCCCC(=O)CCN1C(=O)C=CC1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C10H14N2O3.C2HF3O2/c11-6-1-2-8(13)5-7-12-9(14)3-4-10(12)15;3-2(4,5)1(6)7/h3-4H,1-2,5-7,11H2;(H,6,7) |
| InChIKey | UYTBKZDZUWGXPD-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.25 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|