C26H23Cl2N3O3S — CID 70983515
3-[3-chloro-4-[3-(2-oxa-6-azaspiro[3.3]heptan-6-yl)propoxy]phenyl]-6-(4-chlorophenyl)thieno[3,2-d]pyrimidin-4-one (PubChem CID 70983515) has the molecular formula C26H23Cl2N3O3S and a molecular weight of 528.46 g/mol. Its IUPAC name is 3-[3-chloro-4-[3-(2-oxa-6-azaspiro[3.3]heptan-6-yl)propoxy]phenyl]-6-(4-chlorophenyl)thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 3-[3-chloro-4-[3-(2-oxa-6-azaspiro[3.3]heptan-6-yl)propoxy]phenyl]-6-(4-chlorophenyl)thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 70983515 |
| Molecular Formula | C26H23Cl2N3O3S |
| Molecular Weight | 528.46 g/mol |
| Exact Mass | 527.08 |
| IUPAC Name | 3-[3-chloro-4-[3-(2-oxa-6-azaspiro[3.3]heptan-6-yl)propoxy]phenyl]-6-(4-chlorophenyl)thieno[3,2-d]pyrimidin-4-one |
| SMILES | O=c1c2sc(-c3ccc(Cl)cc3)cc2ncn1-c1ccc(OCCCN2CC3(COC3)C2)c(Cl)c1 |
| InChI | InChI=1S/C26H23Cl2N3O3S/c27-18-4-2-17(3-5-18)23-11-21-24(35-23)25(32)31(16-29-21)19-6-7-22(20(28)10-19)34-9-1-8-30-12-26(13-30)14-33-15-26/h2-7,10-11,16H,1,8-9,12-15H2 |
| InChIKey | IWQZBVCDYXKLCF-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.46 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|