C8H13F3N2O — CID 70984536
4,4,4-trifluoro-2-pyrrolidin-3-ylbutanamide (PubChem CID 70984536) has the molecular formula C8H13F3N2O and a molecular weight of 210.20 g/mol. Its IUPAC name is 4,4,4-trifluoro-2-pyrrolidin-3-ylbutanamide.
| Compound Name | 4,4,4-trifluoro-2-pyrrolidin-3-ylbutanamide |
|---|---|
| PubChem CID | 70984536 |
| Molecular Formula | C8H13F3N2O |
| Molecular Weight | 210.20 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 4,4,4-trifluoro-2-pyrrolidin-3-ylbutanamide |
| SMILES | NC(=O)C(CC(F)(F)F)C1CCNC1 |
| InChI | InChI=1S/C8H13F3N2O/c9-8(10,11)3-6(7(12)14)5-1-2-13-4-5/h5-6,13H,1-4H2,(H2,12,14) |
| InChIKey | SYXHJHMBOMKMCE-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.20 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |