C7H12F3N3O — CID 71015507
1-pyrrolidin-3-yl-1-(1,1,2-trifluoroethyl)urea (PubChem CID 71015507) has the molecular formula C7H12F3N3O and a molecular weight of 211.19 g/mol. Its IUPAC name is 1-pyrrolidin-3-yl-1-(1,1,2-trifluoroethyl)urea.
| Compound Name | 1-pyrrolidin-3-yl-1-(1,1,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 71015507 |
| Molecular Formula | C7H12F3N3O |
| Molecular Weight | 211.19 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | 1-pyrrolidin-3-yl-1-(1,1,2-trifluoroethyl)urea |
| SMILES | NC(=O)N(C1CCNC1)C(F)(F)CF |
| InChI | InChI=1S/C7H12F3N3O/c8-4-7(9,10)13(6(11)14)5-1-2-12-3-5/h5,12H,1-4H2,(H2,11,14) |
| InChIKey | RIJDEWNMBKMVNF-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.19 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|