About 3-methyl-6λ4-thiaspiro[5.6]dodecane
3-methyl-6λ4-thiaspiro[5.6]dodecane (PubChem CID 70985048) has the molecular formula C12H24S
and a molecular weight of 200.39 g/mol. Its IUPAC name is 3-methyl-6λ4-thiaspiro[5.6]dodecane.
Molecular Properties
| Compound Name | 3-methyl-6λ4-thiaspiro[5.6]dodecane |
| PubChem CID | 70985048 |
| Molecular Formula | C12H24S |
| Molecular Weight | 200.39 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 3-methyl-6λ4-thiaspiro[5.6]dodecane |
| SMILES | CC1CCS2(CCCCCC2)CC1 |
| InChI | InChI=1S/C12H24S/c1-12-6-10-13(11-7-12)8-4-2-3-5-9-13/h12H,2-11H2,1H3 |
| InChIKey | OUZOLNNRAIMYBM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-methyl-6λ4-thiaspiro[5.6]dodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-6λ4-thiaspiro[5.6]dodecane?
The IUPAC name of 3-methyl-6λ4-thiaspiro[5.6]dodecane (CID 70985048) is 3-methyl-6λ4-thiaspiro[5.6]dodecane.
What is the SMILES notation for 3-methyl-6λ4-thiaspiro[5.6]dodecane?
The canonical SMILES for 3-methyl-6λ4-thiaspiro[5.6]dodecane is CC1CCS2(CCCCCC2)CC1.
What is the InChIKey of 3-methyl-6λ4-thiaspiro[5.6]dodecane?
The InChIKey is OUZOLNNRAIMYBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24S/c1-12-6-10-13(11-7-12)8-4-2-3-5-9-13/h12H,2-11H2,1H3.
What are the key properties of 3-methyl-6λ4-thiaspiro[5.6]dodecane?
3-methyl-6λ4-thiaspiro[5.6]dodecane has a molecular weight of 200.39 g/mol, XLogP of 3.79, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-6λ4-thiaspiro[5.6]dodecane is sourced from PubChem (CID 70985048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).