C19H17N5O2 — CID 70986581
4-[[[1-(3-methylphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]amino]methyl]benzene-1,2-diol (PubChem CID 70986581) has the molecular formula C19H17N5O2 and a molecular weight of 347.38 g/mol. Its IUPAC name is 4-[[[1-(3-methylphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]amino]methyl]benzene-1,2-diol.
| Compound Name | 4-[[[1-(3-methylphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]amino]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 70986581 |
| Molecular Formula | C19H17N5O2 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 4-[[[1-(3-methylphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]amino]methyl]benzene-1,2-diol |
| SMILES | Cc1cccc(-n2ncc3c(NCc4ccc(O)c(O)c4)ncnc32)c1 |
| InChI | InChI=1S/C19H17N5O2/c1-12-3-2-4-14(7-12)24-19-15(10-23-24)18(21-11-22-19)20-9-13-5-6-16(25)17(26)8-13/h2-8,10-11,25-26H,9H2,1H3,(H,20,21,22) |
| InChIKey | DKJISTXTIJCHFJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|