C25H25N5O2Si — CID 59590527
N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-1-[3-(2-trimethylsilylethynyl)phenyl]pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 59590527) has the molecular formula C25H25N5O2Si and a molecular weight of 455.59 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-1-[3-(2-trimethylsilylethynyl)phenyl]pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-1-[3-(2-trimethylsilylethynyl)phenyl]pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 59590527 |
| Molecular Formula | C25H25N5O2Si |
| Molecular Weight | 455.59 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-1-[3-(2-trimethylsilylethynyl)phenyl]pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | C[Si](C)(C)C#Cc1cccc(-n2ncc3c(NCc4ccc5c(c4)OCCO5)ncnc32)c1 |
| InChI | InChI=1S/C25H25N5O2Si/c1-33(2,3)12-9-18-5-4-6-20(13-18)30-25-21(16-29-30)24(27-17-28-25)26-15-19-7-8-22-23(14-19)32-11-10-31-22/h4-8,13-14,16-17H,10-11,15H2,1-3H3,(H,26,27,28) |
| InChIKey | WKWJZJUMLVPAKS-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.59 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|