C26H25I — CID 70987206
(2S)-2-iodo-2,9,9-trimethyl-7-naphthalen-1-yl-3,9a-dihydro-1H-fluorene (PubChem CID 70987206) has the molecular formula C26H25I and a molecular weight of 464.39 g/mol. Its IUPAC name is (2S)-2-iodo-2,9,9-trimethyl-7-naphthalen-1-yl-3,9a-dihydro-1H-fluorene.
| Compound Name | (2S)-2-iodo-2,9,9-trimethyl-7-naphthalen-1-yl-3,9a-dihydro-1H-fluorene |
|---|---|
| PubChem CID | 70987206 |
| Molecular Formula | C26H25I |
| Molecular Weight | 464.39 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | (2S)-2-iodo-2,9,9-trimethyl-7-naphthalen-1-yl-3,9a-dihydro-1H-fluorene |
| SMILES | CC1(C)c2cc(-c3cccc4ccccc34)ccc2C2=CC[C@](C)(I)CC21 |
| InChI | InChI=1S/C26H25I/c1-25(2)23-15-18(20-10-6-8-17-7-4-5-9-19(17)20)11-12-21(23)22-13-14-26(3,27)16-24(22)25/h4-13,15,24H,14,16H2,1-3H3/t24?,26-/m0/s1 |
| InChIKey | DFWUYPSHAAATAQ-JKGBFCRXSA-N |
| XLogP | 7.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.39 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|