C17H21NO3 — CID 70987584
(1S)-3-amino-1-(2-ethoxyphenoxy)-1-phenylpropan-2-ol (PubChem CID 70987584) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is (1S)-3-amino-1-(2-ethoxyphenoxy)-1-phenylpropan-2-ol.
| Compound Name | (1S)-3-amino-1-(2-ethoxyphenoxy)-1-phenylpropan-2-ol |
|---|---|
| PubChem CID | 70987584 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | (1S)-3-amino-1-(2-ethoxyphenoxy)-1-phenylpropan-2-ol |
| SMILES | CCOc1ccccc1O[C@@H](c1ccccc1)C(O)CN |
| InChI | InChI=1S/C17H21NO3/c1-2-20-15-10-6-7-11-16(15)21-17(14(19)12-18)13-8-4-3-5-9-13/h3-11,14,17,19H,2,12,18H2,1H3/t14?,17-/m0/s1 |
| InChIKey | NSRLBJFRMMPGOK-JRZJBTRGSA-N |
| XLogP | 2.53 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |