C18H25NO6S — CID 46780268
3-amino-1-(2-ethoxyphenoxy)-1-phenylpropan-2-ol;methanesulfonic acid (PubChem CID 46780268) has the molecular formula C18H25NO6S and a molecular weight of 383.47 g/mol. Its IUPAC name is 3-amino-1-(2-ethoxyphenoxy)-1-phenylpropan-2-ol;methanesulfonic acid.
| Compound Name | 3-amino-1-(2-ethoxyphenoxy)-1-phenylpropan-2-ol;methanesulfonic acid |
|---|---|
| PubChem CID | 46780268 |
| Molecular Formula | C18H25NO6S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 3-amino-1-(2-ethoxyphenoxy)-1-phenylpropan-2-ol;methanesulfonic acid |
| SMILES | CCOc1ccccc1OC(c1ccccc1)C(O)CN.CS(=O)(=O)O |
| InChI | InChI=1S/C17H21NO3.CH4O3S/c1-2-20-15-10-6-7-11-16(15)21-17(14(19)12-18)13-8-4-3-5-9-13;1-5(2,3)4/h3-11,14,17,19H,2,12,18H2,1H3;1H3,(H,2,3,4) |
| InChIKey | YLWMFGZOMMEAOU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|