C12H19O8P2+ — CID 70988505
[(2R,3S,4R,5S)-3,4-dihydroxy-5-(4-methoxyphenoxy)oxolan-2-yl]methoxy-dihydroxy-phosphanylphosphanium (PubChem CID 70988505) has the molecular formula C12H19O8P2+ and a molecular weight of 353.22 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-3,4-dihydroxy-5-(4-methoxyphenoxy)oxolan-2-yl]methoxy-dihydroxy-phosphanylphosphanium.
| Compound Name | [(2R,3S,4R,5S)-3,4-dihydroxy-5-(4-methoxyphenoxy)oxolan-2-yl]methoxy-dihydroxy-phosphanylphosphanium |
|---|---|
| PubChem CID | 70988505 |
| Molecular Formula | C12H19O8P2+ |
| Molecular Weight | 353.22 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | [(2R,3S,4R,5S)-3,4-dihydroxy-5-(4-methoxyphenoxy)oxolan-2-yl]methoxy-dihydroxy-phosphanylphosphanium |
| SMILES | COc1ccc(O[C@@H]2O[C@H](CO[P+](O)(O)P)[C@@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C12H19O8P2/c1-17-7-2-4-8(5-3-7)19-12-11(14)10(13)9(20-12)6-18-22(15,16)21/h2-5,9-16H,6,21H2,1H3/q+1/t9-,10-,11-,12-/m1/s1 |
| InChIKey | LTCYHDVCDPWVFF-DDHJBXDOSA-N |
| XLogP | 0.07 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.22 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|