C20H31NO4S — CID 70989127
methyl 3-[2-ethylhexanoyl-(4-hydroxycyclohexyl)amino]thiophene-2-carboxylate (PubChem CID 70989127) has the molecular formula C20H31NO4S and a molecular weight of 381.54 g/mol. Its IUPAC name is methyl 3-[2-ethylhexanoyl-(4-hydroxycyclohexyl)amino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[2-ethylhexanoyl-(4-hydroxycyclohexyl)amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 70989127 |
| Molecular Formula | C20H31NO4S |
| Molecular Weight | 381.54 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | methyl 3-[2-ethylhexanoyl-(4-hydroxycyclohexyl)amino]thiophene-2-carboxylate |
| SMILES | CCCCC(CC)C(=O)N(c1ccsc1C(=O)OC)C1CCC(O)CC1 |
| InChI | InChI=1S/C20H31NO4S/c1-4-6-7-14(5-2)19(23)21(15-8-10-16(22)11-9-15)17-12-13-26-18(17)20(24)25-3/h12-16,22H,4-11H2,1-3H3 |
| InChIKey | DPCKFEHCKKZBDA-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.54 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |