C28H43NO6S2 — CID 89163487
methyl 3-[2-ethylhexanoyl-(4-methylsulfonyloxycyclohexyl)amino]-5-(4-methylidenecyclohexyl)thiophene-2-carboxylate (PubChem CID 89163487) has the molecular formula C28H43NO6S2 and a molecular weight of 553.79 g/mol. Its IUPAC name is methyl 3-[2-ethylhexanoyl-(4-methylsulfonyloxycyclohexyl)amino]-5-(4-methylidenecyclohexyl)thiophene-2-carboxylate.
| Compound Name | methyl 3-[2-ethylhexanoyl-(4-methylsulfonyloxycyclohexyl)amino]-5-(4-methylidenecyclohexyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 89163487 |
| Molecular Formula | C28H43NO6S2 |
| Molecular Weight | 553.79 g/mol |
| Exact Mass | 553.25 |
| IUPAC Name | methyl 3-[2-ethylhexanoyl-(4-methylsulfonyloxycyclohexyl)amino]-5-(4-methylidenecyclohexyl)thiophene-2-carboxylate |
| SMILES | C=C1CCC(c2cc(N(C(=O)C(CC)CCCC)C3CCC(OS(C)(=O)=O)CC3)c(C(=O)OC)s2)CC1 |
| InChI | InChI=1S/C28H43NO6S2/c1-6-8-9-20(7-2)27(30)29(22-14-16-23(17-15-22)35-37(5,32)33)24-18-25(36-26(24)28(31)34-4)21-12-10-19(3)11-13-21/h18,20-23H,3,6-17H2,1-2,4-5H3 |
| InChIKey | PUJMLPXJLVAVRA-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.79 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|