C28H32N6O — CID 70989404
1-[4-(dipropylamino)-6-(3-methylanilino)quinazolin-2-yl]-3-phenylurea (PubChem CID 70989404) has the molecular formula C28H32N6O and a molecular weight of 468.61 g/mol. Its IUPAC name is 1-[4-(dipropylamino)-6-(3-methylanilino)quinazolin-2-yl]-3-phenylurea.
| Compound Name | 1-[4-(dipropylamino)-6-(3-methylanilino)quinazolin-2-yl]-3-phenylurea |
|---|---|
| PubChem CID | 70989404 |
| Molecular Formula | C28H32N6O |
| Molecular Weight | 468.61 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | 1-[4-(dipropylamino)-6-(3-methylanilino)quinazolin-2-yl]-3-phenylurea |
| SMILES | CCCN(CCC)c1nc(NC(=O)Nc2ccccc2)nc2ccc(Nc3cccc(C)c3)cc12 |
| InChI | InChI=1S/C28H32N6O/c1-4-16-34(17-5-2)26-24-19-23(29-22-13-9-10-20(3)18-22)14-15-25(24)31-27(32-26)33-28(35)30-21-11-7-6-8-12-21/h6-15,18-19,29H,4-5,16-17H2,1-3H3,(H2,30,31,32,33,35) |
| InChIKey | PIALTQKEMBAUBS-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.61 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |