C17H21NO5 — CID 7098966
ethyl (1R,9S,12R)-4-methoxy-9,10-dimethyl-11-oxo-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-12-carboxylate (PubChem CID 7098966) has the molecular formula C17H21NO5 and a molecular weight of 319.36 g/mol. Its IUPAC name is ethyl (1R,9S,12R)-4-methoxy-9,10-dimethyl-11-oxo-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-12-carboxylate.
| Compound Name | ethyl (1R,9S,12R)-4-methoxy-9,10-dimethyl-11-oxo-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-12-carboxylate |
|---|---|
| PubChem CID | 7098966 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | ethyl (1R,9S,12R)-4-methoxy-9,10-dimethyl-11-oxo-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-12-carboxylate |
| SMILES | CCOC(=O)[C@H]1C(=O)N(C)[C@]2(C)C[C@H]1c1cc(OC)ccc1O2 |
| InChI | InChI=1S/C17H21NO5/c1-5-22-16(20)14-12-9-17(2,18(3)15(14)19)23-13-7-6-10(21-4)8-11(12)13/h6-8,12,14H,5,9H2,1-4H3/t12-,14+,17-/m0/s1 |
| InChIKey | NAYYOQYNRDLMCZ-QEORTHHSSA-N |
| XLogP | 1.93 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|