C16H19NO5 — CID 7231285
methyl (1S,9R,12S)-4-methoxy-9,10-dimethyl-11-oxo-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-12-carboxylate (PubChem CID 7231285) has the molecular formula C16H19NO5 and a molecular weight of 305.33 g/mol. Its IUPAC name is methyl (1S,9R,12S)-4-methoxy-9,10-dimethyl-11-oxo-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-12-carboxylate.
| Compound Name | methyl (1S,9R,12S)-4-methoxy-9,10-dimethyl-11-oxo-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-12-carboxylate |
|---|---|
| PubChem CID | 7231285 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | methyl (1S,9R,12S)-4-methoxy-9,10-dimethyl-11-oxo-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-12-carboxylate |
| SMILES | COC(=O)[C@@H]1C(=O)N(C)[C@@]2(C)C[C@@H]1c1cc(OC)ccc1O2 |
| InChI | InChI=1S/C16H19NO5/c1-16-8-11(13(15(19)21-4)14(18)17(16)2)10-7-9(20-3)5-6-12(10)22-16/h5-7,11,13H,8H2,1-4H3/t11-,13+,16-/m1/s1 |
| InChIKey | UDSYFMDBLMHSJP-PVXIVEMSSA-N |
| XLogP | 1.54 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|