C24H23N3O2 — CID 70993049
6-[1-[(1S)-2-hydroxycyclohexyl]-3-pyridin-4-ylpyrazol-4-yl]naphthalen-1-ol (PubChem CID 70993049) has the molecular formula C24H23N3O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 6-[1-[(1S)-2-hydroxycyclohexyl]-3-pyridin-4-ylpyrazol-4-yl]naphthalen-1-ol.
| Compound Name | 6-[1-[(1S)-2-hydroxycyclohexyl]-3-pyridin-4-ylpyrazol-4-yl]naphthalen-1-ol |
|---|---|
| PubChem CID | 70993049 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 6-[1-[(1S)-2-hydroxycyclohexyl]-3-pyridin-4-ylpyrazol-4-yl]naphthalen-1-ol |
| SMILES | Oc1cccc2cc(-c3cn([C@H]4CCCCC4O)nc3-c3ccncc3)ccc12 |
| InChI | InChI=1S/C24H23N3O2/c28-22-7-3-4-17-14-18(8-9-19(17)22)20-15-27(21-5-1-2-6-23(21)29)26-24(20)16-10-12-25-13-11-16/h3-4,7-15,21,23,28-29H,1-2,5-6H2/t21-,23?/m0/s1 |
| InChIKey | RILYHIWSBNWFIQ-BBQAJUCSSA-N |
| XLogP | 4.95 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |