C21H20N2O — CID 166438377
2-(3,4-diphenylpyrazol-1-yl)cyclohexan-1-one (PubChem CID 166438377) has the molecular formula C21H20N2O and a molecular weight of 316.40 g/mol. Its IUPAC name is 2-(3,4-diphenylpyrazol-1-yl)cyclohexan-1-one.
| Compound Name | 2-(3,4-diphenylpyrazol-1-yl)cyclohexan-1-one |
|---|---|
| PubChem CID | 166438377 |
| Molecular Formula | C21H20N2O |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 2-(3,4-diphenylpyrazol-1-yl)cyclohexan-1-one |
| SMILES | O=C1CCCCC1n1cc(-c2ccccc2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H20N2O/c24-20-14-8-7-13-19(20)23-15-18(16-9-3-1-4-10-16)21(22-23)17-11-5-2-6-12-17/h1-6,9-12,15,19H,7-8,13-14H2 |
| InChIKey | OUBACGNQGDLSMB-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |