C38H48FN5O7S — CID 70995438
[(3R,5S)-1-[(Z,2S)-2-(benzylamino)dec-8-enoyl]-5-[[1-(cyclopropylsulfonylcarbamoyl)cyclopropyl]carbamoyl]pyrrolidin-3-yl] 4-fluoro-1,3-dihydroisoindole-2-carboxylate (PubChem CID 70995438) has the molecular formula C38H48FN5O7S and a molecular weight of 737.90 g/mol. Its IUPAC name is [(3R,5S)-1-[(Z,2S)-2-(benzylamino)dec-8-enoyl]-5-[[1-(cyclopropylsulfonylcarbamoyl)cyclopropyl]carbamoyl]pyrrolidin-3-yl] 4-fluoro-1,3-dihydroisoindole-2-carboxylate.
| Compound Name | [(3R,5S)-1-[(Z,2S)-2-(benzylamino)dec-8-enoyl]-5-[[1-(cyclopropylsulfonylcarbamoyl)cyclopropyl]carbamoyl]pyrrolidin-3-yl] 4-fluoro-1,3-dihydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 70995438 |
| Molecular Formula | C38H48FN5O7S |
| Molecular Weight | 737.90 g/mol |
| Exact Mass | 737.33 |
| IUPAC Name | [(3R,5S)-1-[(Z,2S)-2-(benzylamino)dec-8-enoyl]-5-[[1-(cyclopropylsulfonylcarbamoyl)cyclopropyl]carbamoyl]pyrrolidin-3-yl] 4-fluoro-1,3-dihydroisoindole-2-carboxylate |
| SMILES | C/C=C\CCCCC[C@H](NCc1ccccc1)C(=O)N1C[C@H](OC(=O)N2Cc3cccc(F)c3C2)C[C@H]1C(=O)NC1(C(=O)NS(=O)(=O)C2CC2)CC1 |
| InChI | InChI=1S/C38H48FN5O7S/c1-2-3-4-5-6-10-16-32(40-22-26-12-8-7-9-13-26)35(46)44-24-28(51-37(48)43-23-27-14-11-15-31(39)30(27)25-43)21-33(44)34(45)41-38(19-20-38)36(47)42-52(49,50)29-17-18-29/h2-3,7-9,11-15,28-29,32-33,40H,4-6,10,16-25H2,1H3,(H,41,45)(H,42,47)/b3-2-/t28-,32+,33+/m1/s1 |
| InChIKey | STBUGTLYMNKNFZ-DSKJAURISA-N |
| XLogP | 4.19 |
| TPSA | 154.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.90 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|