C9H18O6S — CID 70995956
(3R,6S)-2-(hydroxymethyl)-6-(2-methylsulfanylethoxy)oxane-3,4,5-triol (PubChem CID 70995956) has the molecular formula C9H18O6S and a molecular weight of 254.30 g/mol. Its IUPAC name is (3R,6S)-2-(hydroxymethyl)-6-(2-methylsulfanylethoxy)oxane-3,4,5-triol.
| Compound Name | (3R,6S)-2-(hydroxymethyl)-6-(2-methylsulfanylethoxy)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 70995956 |
| Molecular Formula | C9H18O6S |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | (3R,6S)-2-(hydroxymethyl)-6-(2-methylsulfanylethoxy)oxane-3,4,5-triol |
| SMILES | CSCCO[C@H]1OC(CO)[C@H](O)C(O)C1O |
| InChI | InChI=1S/C9H18O6S/c1-16-3-2-14-9-8(13)7(12)6(11)5(4-10)15-9/h5-13H,2-4H2,1H3/t5?,6-,7?,8?,9-/m0/s1 |
| InChIKey | RURUNHUVVWWZMQ-KXNJGEIOSA-N |
| XLogP | -1.83 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|