C22H30BN4O2S — CID 70997265
CID 70997265 (PubChem CID 70997265) has the molecular formula C22H30BN4O2S and a molecular weight of 425.39 g/mol.
| Compound Name | CID 70997265 |
|---|---|
| PubChem CID | 70997265 |
| Molecular Formula | C22H30BN4O2S |
| Molecular Weight | 425.39 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | — |
| SMILES | O=C([B]c1nncs1)N1CCN(Cc2cccc(OCCC3CCCCC3)c2)CC1 |
| InChI | InChI=1S/C22H30BN4O2S/c28-22(23-21-25-24-17-30-21)27-12-10-26(11-13-27)16-19-7-4-8-20(15-19)29-14-9-18-5-2-1-3-6-18/h4,7-8,15,17-18H,1-3,5-6,9-14,16H2 |
| InChIKey | YBGZHYZIPZBCPR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|