C21H41N3O2 — CID 70998444
(3S)-1-N-decyl-3-N,3-N-diethylpiperidine-1,3-dicarboxamide (PubChem CID 70998444) has the molecular formula C21H41N3O2 and a molecular weight of 367.58 g/mol. Its IUPAC name is (3S)-1-N-decyl-3-N,3-N-diethylpiperidine-1,3-dicarboxamide.
| Compound Name | (3S)-1-N-decyl-3-N,3-N-diethylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 70998444 |
| Molecular Formula | C21H41N3O2 |
| Molecular Weight | 367.58 g/mol |
| Exact Mass | 367.32 |
| IUPAC Name | (3S)-1-N-decyl-3-N,3-N-diethylpiperidine-1,3-dicarboxamide |
| SMILES | CCCCCCCCCCNC(=O)N1CCC[C@H](C(=O)N(CC)CC)C1 |
| InChI | InChI=1S/C21H41N3O2/c1-4-7-8-9-10-11-12-13-16-22-21(26)24-17-14-15-19(18-24)20(25)23(5-2)6-3/h19H,4-18H2,1-3H3,(H,22,26)/t19-/m0/s1 |
| InChIKey | QPFIFCKOOZZCDG-IBGZPJMESA-N |
| XLogP | 4.42 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.58 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|