About 5-(1,1-dioxothiazinan-2-yl)-7-propan-2-yl-1,6-naphthyridin-8-ol
5-(1,1-dioxothiazinan-2-yl)-7-propan-2-yl-1,6-naphthyridin-8-ol (PubChem CID 70998737) has the molecular formula C15H19N3O3S
and a molecular weight of 321.40 g/mol. Its IUPAC name is 5-(1,1-dioxothiazinan-2-yl)-7-propan-2-yl-1,6-naphthyridin-8-ol.
Molecular Properties
| Compound Name | 5-(1,1-dioxothiazinan-2-yl)-7-propan-2-yl-1,6-naphthyridin-8-ol |
| PubChem CID | 70998737 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 5-(1,1-dioxothiazinan-2-yl)-7-propan-2-yl-1,6-naphthyridin-8-ol |
| SMILES | CC(C)c1nc(N2CCCCS2(=O)=O)c2cccnc2c1O |
| InChI | InChI=1S/C15H19N3O3S/c1-10(2)12-14(19)13-11(6-5-7-16-13)15(17-12)18-8-3-4-9-22(18,20)21/h5-7,10,19H,3-4,8-9H2,1-2H3 |
| InChIKey | VOBIVZGEWVYSGS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(1,1-dioxothiazinan-2-yl)-7-propan-2-yl-1,6-naphthyridin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,1-dioxothiazinan-2-yl)-7-propan-2-yl-1,6-naphthyridin-8-ol?
The IUPAC name of 5-(1,1-dioxothiazinan-2-yl)-7-propan-2-yl-1,6-naphthyridin-8-ol (CID 70998737) is 5-(1,1-dioxothiazinan-2-yl)-7-propan-2-yl-1,6-naphthyridin-8-ol.
What is the SMILES notation for 5-(1,1-dioxothiazinan-2-yl)-7-propan-2-yl-1,6-naphthyridin-8-ol?
The canonical SMILES for 5-(1,1-dioxothiazinan-2-yl)-7-propan-2-yl-1,6-naphthyridin-8-ol is CC(C)c1nc(N2CCCCS2(=O)=O)c2cccnc2c1O.
What is the InChIKey of 5-(1,1-dioxothiazinan-2-yl)-7-propan-2-yl-1,6-naphthyridin-8-ol?
The InChIKey is VOBIVZGEWVYSGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O3S/c1-10(2)12-14(19)13-11(6-5-7-16-13)15(17-12)18-8-3-4-9-22(18,20)21/h5-7,10,19H,3-4,8-9H2,1-2H3.
What are the key properties of 5-(1,1-dioxothiazinan-2-yl)-7-propan-2-yl-1,6-naphthyridin-8-ol?
5-(1,1-dioxothiazinan-2-yl)-7-propan-2-yl-1,6-naphthyridin-8-ol has a molecular weight of 321.40 g/mol, XLogP of 2.39, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,1-dioxothiazinan-2-yl)-7-propan-2-yl-1,6-naphthyridin-8-ol is sourced from PubChem (CID 70998737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).