C18H24N6O — CID 70999666
1-(2-ethoxyethyl)-3-ethyl-5-methyl-N-(4-methyl-2-pyridinyl)pyrazolo[4,5-d]pyrimidin-7-amine (PubChem CID 70999666) has the molecular formula C18H24N6O and a molecular weight of 340.43 g/mol. Its IUPAC name is 1-(2-ethoxyethyl)-3-ethyl-5-methyl-N-(4-methyl-2-pyridinyl)pyrazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | 1-(2-ethoxyethyl)-3-ethyl-5-methyl-N-(4-methyl-2-pyridinyl)pyrazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 70999666 |
| Molecular Formula | C18H24N6O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 1-(2-ethoxyethyl)-3-ethyl-5-methyl-N-(4-methyl-2-pyridinyl)pyrazolo[4,5-d]pyrimidin-7-amine |
| SMILES | CCOCCn1nc(CC)c2nc(C)nc(Nc3cc(C)ccn3)c21 |
| InChI | InChI=1S/C18H24N6O/c1-5-14-16-17(24(23-14)9-10-25-6-2)18(21-13(4)20-16)22-15-11-12(3)7-8-19-15/h7-8,11H,5-6,9-10H2,1-4H3,(H,19,20,21,22) |
| InChIKey | RMMVXGQCXCOCEI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|