C26H28F4O — CID 71001338
3-[2-[4-(2,3-difluoro-4-methoxyphenyl)-2,3-difluorophenyl]ethyl]-6-propyl-1,2,3,3a,4,6a-hexahydropentalene (PubChem CID 71001338) has the molecular formula C26H28F4O and a molecular weight of 432.50 g/mol. Its IUPAC name is 3-[2-[4-(2,3-difluoro-4-methoxyphenyl)-2,3-difluorophenyl]ethyl]-6-propyl-1,2,3,3a,4,6a-hexahydropentalene.
| Compound Name | 3-[2-[4-(2,3-difluoro-4-methoxyphenyl)-2,3-difluorophenyl]ethyl]-6-propyl-1,2,3,3a,4,6a-hexahydropentalene |
|---|---|
| PubChem CID | 71001338 |
| Molecular Formula | C26H28F4O |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | 3-[2-[4-(2,3-difluoro-4-methoxyphenyl)-2,3-difluorophenyl]ethyl]-6-propyl-1,2,3,3a,4,6a-hexahydropentalene |
| SMILES | CCCC1=CCC2C(CCc3ccc(-c4ccc(OC)c(F)c4F)c(F)c3F)CCC12 |
| InChI | InChI=1S/C26H28F4O/c1-3-4-15-7-10-19-16(8-11-18(15)19)5-6-17-9-12-20(24(28)23(17)27)21-13-14-22(31-2)26(30)25(21)29/h7,9,12-14,16,18-19H,3-6,8,10-11H2,1-2H3 |
| InChIKey | CTWHIAYBOWGVQC-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|