C23H20FN5O2 — CID 71001864
2-amino-1-ethyl-7-[3-(3-fluorophenyl)-3-hydroxybut-1-ynyl]-3-(1H-imidazol-2-yl)-1,8-naphthyridin-4-one (PubChem CID 71001864) has the molecular formula C23H20FN5O2 and a molecular weight of 417.44 g/mol. Its IUPAC name is 2-amino-1-ethyl-7-[3-(3-fluorophenyl)-3-hydroxybut-1-ynyl]-3-(1H-imidazol-2-yl)-1,8-naphthyridin-4-one.
| Compound Name | 2-amino-1-ethyl-7-[3-(3-fluorophenyl)-3-hydroxybut-1-ynyl]-3-(1H-imidazol-2-yl)-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 71001864 |
| Molecular Formula | C23H20FN5O2 |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 2-amino-1-ethyl-7-[3-(3-fluorophenyl)-3-hydroxybut-1-ynyl]-3-(1H-imidazol-2-yl)-1,8-naphthyridin-4-one |
| SMILES | CCn1c(N)c(-c2ncc[nH]2)c(=O)c2ccc(C#CC(C)(O)c3cccc(F)c3)nc21 |
| InChI | InChI=1S/C23H20FN5O2/c1-3-29-20(25)18(21-26-11-12-27-21)19(30)17-8-7-16(28-22(17)29)9-10-23(2,31)14-5-4-6-15(24)13-14/h4-8,11-13,31H,3,25H2,1-2H3,(H,26,27) |
| InChIKey | MLODMXUAQDBGLY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|