C21H21N2O3- — CID 7100245
2-[3-[(4-tert-butylphenyl)methyl]-4-oxophthalazin-1-yl]acetate (PubChem CID 7100245) has the molecular formula C21H21N2O3- and a molecular weight of 349.41 g/mol. Its IUPAC name is 2-[3-[(4-tert-butylphenyl)methyl]-4-oxophthalazin-1-yl]acetate.
| Compound Name | 2-[3-[(4-tert-butylphenyl)methyl]-4-oxophthalazin-1-yl]acetate |
|---|---|
| PubChem CID | 7100245 |
| Molecular Formula | C21H21N2O3- |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 2-[3-[(4-tert-butylphenyl)methyl]-4-oxophthalazin-1-yl]acetate |
| SMILES | CC(C)(C)c1ccc(Cn2nc(CC(=O)[O-])c3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C21H22N2O3/c1-21(2,3)15-10-8-14(9-11-15)13-23-20(26)17-7-5-4-6-16(17)18(22-23)12-19(24)25/h4-11H,12-13H2,1-3H3,(H,24,25)/p-1 |
| InChIKey | QVYLMGHNOUKUDL-UHFFFAOYSA-M |
| XLogP | 2.03 |
| TPSA | 75.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |