C20H27N3O6S — CID 7100487
dimethyl (2R,4S)-3-[2-[4-(4-methoxyphenyl)piperazin-1-yl]acetyl]-1,3-thiazolidine-2,4-dicarboxylate (PubChem CID 7100487) has the molecular formula C20H27N3O6S and a molecular weight of 437.52 g/mol. Its IUPAC name is dimethyl (2R,4S)-3-[2-[4-(4-methoxyphenyl)piperazin-1-yl]acetyl]-1,3-thiazolidine-2,4-dicarboxylate.
| Compound Name | dimethyl (2R,4S)-3-[2-[4-(4-methoxyphenyl)piperazin-1-yl]acetyl]-1,3-thiazolidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 7100487 |
| Molecular Formula | C20H27N3O6S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | dimethyl (2R,4S)-3-[2-[4-(4-methoxyphenyl)piperazin-1-yl]acetyl]-1,3-thiazolidine-2,4-dicarboxylate |
| SMILES | COC(=O)[C@H]1CS[C@H](C(=O)OC)N1C(=O)CN1CCN(c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C20H27N3O6S/c1-27-15-6-4-14(5-7-15)22-10-8-21(9-11-22)12-17(24)23-16(19(25)28-2)13-30-18(23)20(26)29-3/h4-7,16,18H,8-13H2,1-3H3/t16-,18-/m1/s1 |
| InChIKey | LVGYSMKAQBPGID-SJLPKXTDSA-N |
| XLogP | 0.43 |
| TPSA | 88.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|