C23H28N4O2 — CID 71007766
2-(4-methoxyphenyl)-1-(14-methyl-6,10,13,15-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11,13,15-tetraen-10-yl)propan-2-ol (PubChem CID 71007766) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-1-(14-methyl-6,10,13,15-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11,13,15-tetraen-10-yl)propan-2-ol.
| Compound Name | 2-(4-methoxyphenyl)-1-(14-methyl-6,10,13,15-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11,13,15-tetraen-10-yl)propan-2-ol |
|---|---|
| PubChem CID | 71007766 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 2-(4-methoxyphenyl)-1-(14-methyl-6,10,13,15-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11,13,15-tetraen-10-yl)propan-2-ol |
| SMILES | COc1ccc(C(C)(O)Cn2c3c(c4nc(C)ncc42)C2CCCN2CC3)cc1 |
| InChI | InChI=1S/C23H28N4O2/c1-15-24-13-20-22(25-15)21-18-5-4-11-26(18)12-10-19(21)27(20)14-23(2,28)16-6-8-17(29-3)9-7-16/h6-9,13,18,28H,4-5,10-12,14H2,1-3H3 |
| InChIKey | NXSBQRZOAVIKFB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |