C22H26N4O — CID 71008424
2-(15-methyl-7,11,14,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),12,14,16-tetraen-11-yl)-1-phenylethanol (PubChem CID 71008424) has the molecular formula C22H26N4O and a molecular weight of 362.48 g/mol. Its IUPAC name is 2-(15-methyl-7,11,14,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),12,14,16-tetraen-11-yl)-1-phenylethanol.
| Compound Name | 2-(15-methyl-7,11,14,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),12,14,16-tetraen-11-yl)-1-phenylethanol |
|---|---|
| PubChem CID | 71008424 |
| Molecular Formula | C22H26N4O |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 2-(15-methyl-7,11,14,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),12,14,16-tetraen-11-yl)-1-phenylethanol |
| SMILES | Cc1ncc2c(n1)c1c(n2CC(O)c2ccccc2)CCN2CCCCC12 |
| InChI | InChI=1S/C22H26N4O/c1-15-23-13-19-22(24-15)21-17-9-5-6-11-25(17)12-10-18(21)26(19)14-20(27)16-7-3-2-4-8-16/h2-4,7-8,13,17,20,27H,5-6,9-12,14H2,1H3 |
| InChIKey | RFQAAYXDLKCCKC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |