C19H23N5O — CID 71007540
2-(10-methyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-7-yl)-1-(2H-triazol-4-yl)ethanol (PubChem CID 71007540) has the molecular formula C19H23N5O and a molecular weight of 337.43 g/mol. Its IUPAC name is 2-(10-methyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-7-yl)-1-(2H-triazol-4-yl)ethanol.
| Compound Name | 2-(10-methyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-7-yl)-1-(2H-triazol-4-yl)ethanol |
|---|---|
| PubChem CID | 71007540 |
| Molecular Formula | C19H23N5O |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 2-(10-methyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-7-yl)-1-(2H-triazol-4-yl)ethanol |
| SMILES | Cc1ccc2c(c1)c1c(n2CC(O)c2cn[nH]n2)CCN2CCCC12 |
| InChI | InChI=1S/C19H23N5O/c1-12-4-5-15-13(9-12)19-16-3-2-7-23(16)8-6-17(19)24(15)11-18(25)14-10-20-22-21-14/h4-5,9-10,16,18,25H,2-3,6-8,11H2,1H3,(H,20,21,22) |
| InChIKey | ZPACMDNZWLXVGC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|