C27H36FN3 — CID 161420871
2-(4-fluorophenyl)-N,N-dimethyl-1-(10-methyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-7-yl)propan-2-amine;methane (PubChem CID 161420871) has the molecular formula C27H36FN3 and a molecular weight of 421.60 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N,N-dimethyl-1-(10-methyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-7-yl)propan-2-amine;methane.
| Compound Name | 2-(4-fluorophenyl)-N,N-dimethyl-1-(10-methyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-7-yl)propan-2-amine;methane |
|---|---|
| PubChem CID | 161420871 |
| Molecular Formula | C27H36FN3 |
| Molecular Weight | 421.60 g/mol |
| Exact Mass | 421.29 |
| IUPAC Name | 2-(4-fluorophenyl)-N,N-dimethyl-1-(10-methyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-7-yl)propan-2-amine;methane |
| SMILES | C.Cc1ccc2c(c1)c1c(n2CC(C)(c2ccc(F)cc2)N(C)C)CCN2CCCC12 |
| InChI | InChI=1S/C26H32FN3.CH4/c1-18-7-12-22-21(16-18)25-23-6-5-14-29(23)15-13-24(25)30(22)17-26(2,28(3)4)19-8-10-20(27)11-9-19;/h7-12,16,23H,5-6,13-15,17H2,1-4H3;1H4 |
| InChIKey | VWSINJOWSOCANB-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 11.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.60 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|