C22H25N7 — CID 71008314
7-(2-azido-2-pyrazin-2-ylpropyl)-10-methyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indole (PubChem CID 71008314) has the molecular formula C22H25N7 and a molecular weight of 387.49 g/mol. Its IUPAC name is 7-(2-azido-2-pyrazin-2-ylpropyl)-10-methyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indole.
| Compound Name | 7-(2-azido-2-pyrazin-2-ylpropyl)-10-methyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indole |
|---|---|
| PubChem CID | 71008314 |
| Molecular Formula | C22H25N7 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 7-(2-azido-2-pyrazin-2-ylpropyl)-10-methyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indole |
| SMILES | Cc1ccc2c(c1)c1c(n2CC(C)(N=[N+]=[N-])c2cnccn2)CCN2CCCC12 |
| InChI | InChI=1S/C22H25N7/c1-15-5-6-17-16(12-15)21-18-4-3-10-28(18)11-7-19(21)29(17)14-22(2,26-27-23)20-13-24-8-9-25-20/h5-6,8-9,12-13,18H,3-4,7,10-11,14H2,1-2H3 |
| InChIKey | TVWJGSRXCYNQBC-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 82.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|