C22H24ClN3O — CID 118481782
(1S)-2-(8-chloro-10-methyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-7-yl)-1-pyridin-4-ylethanol (PubChem CID 118481782) has the molecular formula C22H24ClN3O and a molecular weight of 381.91 g/mol. Its IUPAC name is (1S)-2-(8-chloro-10-methyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-7-yl)-1-pyridin-4-ylethanol.
| Compound Name | (1S)-2-(8-chloro-10-methyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-7-yl)-1-pyridin-4-ylethanol |
|---|---|
| PubChem CID | 118481782 |
| Molecular Formula | C22H24ClN3O |
| Molecular Weight | 381.91 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | (1S)-2-(8-chloro-10-methyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-7-yl)-1-pyridin-4-ylethanol |
| SMILES | Cc1cc(Cl)c2c(c1)c1c(n2C[C@@H](O)c2ccncc2)CCN2CCCC12 |
| InChI | InChI=1S/C22H24ClN3O/c1-14-11-16-21-18-3-2-9-25(18)10-6-19(21)26(22(16)17(23)12-14)13-20(27)15-4-7-24-8-5-15/h4-5,7-8,11-12,18,20,27H,2-3,6,9-10,13H2,1H3/t18?,20-/m1/s1 |
| InChIKey | MUWUQRPQHJJTFC-ROPPNANJSA-N |
| XLogP | 4.42 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.91 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|