C20H20N4O — CID 71010403
1-tert-butyl-3-naphthalen-1-yloxypyrazolo[3,4-b]pyridin-4-amine (PubChem CID 71010403) has the molecular formula C20H20N4O and a molecular weight of 332.41 g/mol. Its IUPAC name is 1-tert-butyl-3-naphthalen-1-yloxypyrazolo[3,4-b]pyridin-4-amine.
| Compound Name | 1-tert-butyl-3-naphthalen-1-yloxypyrazolo[3,4-b]pyridin-4-amine |
|---|---|
| PubChem CID | 71010403 |
| Molecular Formula | C20H20N4O |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 1-tert-butyl-3-naphthalen-1-yloxypyrazolo[3,4-b]pyridin-4-amine |
| SMILES | CC(C)(C)n1nc(Oc2cccc3ccccc23)c2c(N)ccnc21 |
| InChI | InChI=1S/C20H20N4O/c1-20(2,3)24-18-17(15(21)11-12-22-18)19(23-24)25-16-10-6-8-13-7-4-5-9-14(13)16/h4-12H,1-3H3,(H2,21,22) |
| InChIKey | SWLQHMUZYDVTNJ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |