C29H34F3N5O4 — CID 71015339
1-[3-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-4-methyl-1-phenylpyrazol-5-yl]-3-[(3R,4S)-4-phenyl-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]urea (PubChem CID 71015339) has the molecular formula C29H34F3N5O4 and a molecular weight of 573.62 g/mol. Its IUPAC name is 1-[3-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-4-methyl-1-phenylpyrazol-5-yl]-3-[(3R,4S)-4-phenyl-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]urea.
| Compound Name | 1-[3-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-4-methyl-1-phenylpyrazol-5-yl]-3-[(3R,4S)-4-phenyl-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 71015339 |
| Molecular Formula | C29H34F3N5O4 |
| Molecular Weight | 573.62 g/mol |
| Exact Mass | 573.26 |
| IUPAC Name | 1-[3-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-4-methyl-1-phenylpyrazol-5-yl]-3-[(3R,4S)-4-phenyl-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]urea |
| SMILES | Cc1c(OC[C@H]2COC(C)(C)O2)nn(-c2ccccc2)c1NC(=O)N[C@H]1CN(CC(F)(F)F)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C29H34F3N5O4/c1-19-25(37(21-12-8-5-9-13-21)35-26(19)39-16-22-17-40-28(2,3)41-22)34-27(38)33-24-15-36(18-29(30,31)32)14-23(24)20-10-6-4-7-11-20/h4-13,22-24H,14-18H2,1-3H3,(H2,33,34,38)/t22-,23+,24-/m0/s1 |
| InChIKey | ZOSBOANPLDJVBP-VXNXHJTFSA-N |
| XLogP | 4.86 |
| TPSA | 89.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.62 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |