C30H36F3N5O5 — CID 71015412
1-[3-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-4-methyl-1-phenylpyrazol-5-yl]-3-[(3S,4R)-1-(2-methoxyethyl)-4-(3,4,5-trifluorophenyl)pyrrolidin-3-yl]urea (PubChem CID 71015412) has the molecular formula C30H36F3N5O5 and a molecular weight of 603.64 g/mol. Its IUPAC name is 1-[3-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-4-methyl-1-phenylpyrazol-5-yl]-3-[(3S,4R)-1-(2-methoxyethyl)-4-(3,4,5-trifluorophenyl)pyrrolidin-3-yl]urea.
| Compound Name | 1-[3-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-4-methyl-1-phenylpyrazol-5-yl]-3-[(3S,4R)-1-(2-methoxyethyl)-4-(3,4,5-trifluorophenyl)pyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 71015412 |
| Molecular Formula | C30H36F3N5O5 |
| Molecular Weight | 603.64 g/mol |
| Exact Mass | 603.27 |
| IUPAC Name | 1-[3-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-4-methyl-1-phenylpyrazol-5-yl]-3-[(3S,4R)-1-(2-methoxyethyl)-4-(3,4,5-trifluorophenyl)pyrrolidin-3-yl]urea |
| SMILES | COCCN1C[C@@H](NC(=O)Nc2c(C)c(OC[C@@H]3COC(C)(C)O3)nn2-c2ccccc2)[C@H](c2cc(F)c(F)c(F)c2)C1 |
| InChI | InChI=1S/C30H36F3N5O5/c1-18-27(38(20-8-6-5-7-9-20)36-28(18)41-16-21-17-42-30(2,3)43-21)35-29(39)34-25-15-37(10-11-40-4)14-22(25)19-12-23(31)26(33)24(32)13-19/h5-9,12-13,21-22,25H,10-11,14-17H2,1-4H3,(H2,34,35,39)/t21-,22+,25-/m1/s1 |
| InChIKey | LBKSNDJJDAMONY-OTNCWRBYSA-N |
| XLogP | 4.36 |
| TPSA | 99.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.64 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|