C47H35N2P — CID 71016750
[4-[1-(4-methylphenyl)-2,6-bis(4-phenylphenyl)pyrrolo[2,3-f]indol-5-yl]phenyl]phosphane (PubChem CID 71016750) has the molecular formula C47H35N2P and a molecular weight of 658.79 g/mol. Its IUPAC name is [4-[1-(4-methylphenyl)-2,6-bis(4-phenylphenyl)pyrrolo[2,3-f]indol-5-yl]phenyl]phosphane.
| Compound Name | [4-[1-(4-methylphenyl)-2,6-bis(4-phenylphenyl)pyrrolo[2,3-f]indol-5-yl]phenyl]phosphane |
|---|---|
| PubChem CID | 71016750 |
| Molecular Formula | C47H35N2P |
| Molecular Weight | 658.79 g/mol |
| Exact Mass | 658.25 |
| IUPAC Name | [4-[1-(4-methylphenyl)-2,6-bis(4-phenylphenyl)pyrrolo[2,3-f]indol-5-yl]phenyl]phosphane |
| SMILES | Cc1ccc(-n2c(-c3ccc(-c4ccccc4)cc3)cc3cc4c(cc(-c5ccc(-c6ccccc6)cc5)n4-c4ccc(P)cc4)cc32)cc1 |
| InChI | InChI=1S/C47H35N2P/c1-32-12-22-41(23-13-32)48-44(37-18-14-35(15-19-37)33-8-4-2-5-9-33)28-39-31-47-40(30-46(39)48)29-45(49(47)42-24-26-43(50)27-25-42)38-20-16-36(17-21-38)34-10-6-3-7-11-34/h2-31H,50H2,1H3 |
| InChIKey | ZXFLOYOMLRRQQF-UHFFFAOYSA-N |
| XLogP | 12.05 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.79 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|