C35H35BFN2O3 — CID 71017500
CID 71017500 (PubChem CID 71017500) has the molecular formula C35H35BFN2O3 and a molecular weight of 561.49 g/mol.
| Compound Name | CID 71017500 |
|---|---|
| PubChem CID | 71017500 |
| Molecular Formula | C35H35BFN2O3 |
| Molecular Weight | 561.49 g/mol |
| Exact Mass | 561.27 |
| IUPAC Name | — |
| SMILES | COc1ccc(-c2nn(C(c3ccccc3)(c3ccccc3)c3ccccc3)cc2[B]OC(C)(C)C(C)(C)O)c(F)c1 |
| InChI | InChI=1S/C35H35BFN2O3/c1-33(2,40)34(3,4)42-36-30-24-39(38-32(30)29-22-21-28(41-5)23-31(29)37)35(25-15-9-6-10-16-25,26-17-11-7-12-18-26)27-19-13-8-14-20-27/h6-24,40H,1-5H3 |
| InChIKey | OSWKEEUWLGIMPU-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.49 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|